Difference between revisions of "SJ12220"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Oxo-carboxylates 2-Oxo-carboxylates] == * common-name: ** a 2-oxo carboxylate == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-pinobanksin |
| + | * smiles: | ||
| + | ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) | ||
| + | * inchi-key: | ||
| + | ** suyjzkrqhbqnca-lsdhhaiusa-m | ||
| + | * molecular-weight: | ||
| + | ** 271.249 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7648]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-pinobanksin}} |
| + | {{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}} | ||
| + | {{#set: molecular-weight=271.249}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-6992
- common-name:
- (+)-pinobanksin
- smiles:
- c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
- inchi-key:
- suyjzkrqhbqnca-lsdhhaiusa-m
- molecular-weight:
- 271.249
