Difference between revisions of "SJ13009"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-DELTA3-ENOYL-COA CIS-DELTA3-ENOYL-COA] == * common-name: ** a (3z)-alkan-3-enoyl-coa == Rea...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate |
+ | * smiles: | ||
+ | ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** zbcbetmbsdtinl-nwjcxacmsa-l | ||
+ | * molecular-weight: | ||
+ | ** 170.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1K-87]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}} |
+ | {{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}} | ||
+ | {{#set: molecular-weight=170.121}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-787
- common-name:
- (2z,4z)-2-hydroxyhepta-2,4-dienedioate
- smiles:
- c([o-])(=o)cc=cc=c(o)c(=o)[o-]
- inchi-key:
- zbcbetmbsdtinl-nwjcxacmsa-l
- molecular-weight:
- 170.121