Difference between revisions of "SJ16318"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * common-name: ** n-(5-phos...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=56-Dihydrouracil47-in-tRNAs 56-Dihydrouracil47-in-tRNAs] == * common-name: ** a 5,6-dihydrourac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=56-Dihydrouracil47-in-tRNAs 56-Dihydrouracil47-in-tRNAs] ==
 
* common-name:
 
* common-name:
** n-(5-phosphoribosyl)-anthranilate
+
** a 5,6-dihydrouracil47 in trna
* smiles:
 
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
 
* inchi-key:
 
** pmfmjxprnjuymb-gwofurmssa-k
 
* molecular-weight:
 
** 346.21
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PRAISOM-RXN]]
 
* [[PRTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRTRANS-RXN]]
+
* [[RXN-12457]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-(5-phosphoribosyl)-anthranilate}}
+
{{#set: common-name=a 5,6-dihydrouracil47 in trna}}
{{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}}
 
{{#set: molecular-weight=346.21}}
 

Revision as of 09:23, 27 August 2019

Metabolite 56-Dihydrouracil47-in-tRNAs

  • common-name:
    • a 5,6-dihydrouracil47 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality