Difference between revisions of "SJ19766"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARABITOL L-ARABITOL] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] ==
 * common-name:
-** l-arabinitol
+** oleate
 * smiles:
-** c(c(c(c(co)o)o)o)o
+** ccccccccc=ccccccccc([o-])=o
 * inchi-key:
-** hebkchpvoiaqta-imjsidkusa-n
+** zqppmhvwecsirj-ktkrtigzsa-m
 * molecular-weight:
-** 152.147
+** 281.457
 == Reaction(s) known to consume the compound ==
-* [[RXN-14102]]
+* [[FACOAL18111Z]]
-* [[RXN-8772]]
+* [[RXN-10756]]
+* [[RXN-9644]]
+* [[RXN0-7239]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14102]]
+* [[FACOAE18111Z]]
-* [[RXN-8772]]
+* [[RXN-10756]]
+* [[RXN-15035]]
+* [[RXN-15067]]
+* [[RXN-15068]]
+* [[RXN-15088]]
+* [[RXN-15089]]
+* [[RXN-15133]]
+* [[RXN-15135]]
+* [[RXN-9666]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-arabinitol}}
+{{#set: common-name=oleate}}
-{{#set: inchi-key=inchikey=hebkchpvoiaqta-imjsidkusa-n}}
+{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
-{{#set: molecular-weight=152.147}}
+{{#set: molecular-weight=281.457}}