Difference between revisions of "SJ17935"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17399 CPD-17399] == * common-name: ** a [glycerolipid]-auricolate == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,4-dihydroxyphenylglycol |
+ | * smiles: | ||
+ | ** c(o)c(o)c1(c=cc(o)=c(o)c=1) | ||
+ | * inchi-key: | ||
+ | ** mtvwfvdwrvydor-qmmmgpobsa-n | ||
+ | * molecular-weight: | ||
+ | ** 170.165 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10911]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylglycol}} |
+ | {{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}} | ||
+ | {{#set: molecular-weight=170.165}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-11878
- common-name:
- 3,4-dihydroxyphenylglycol
- smiles:
- c(o)c(o)c1(c=cc(o)=c(o)c=1)
- inchi-key:
- mtvwfvdwrvydor-qmmmgpobsa-n
- molecular-weight:
- 170.165