Difference between revisions of "SJ18485"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8073 CPD-8073] == * common-name: ** 1-18:2-2-16:0-monogalactosyldiacylglycerol * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * common-name: ** pyridoxamine 5'-phosphate * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxamine 5'-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zmjgsosnspkhnh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 247.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PMPOXI-RXN]] |
| + | * [[PYAMPP]] | ||
| + | * [[RXN-14046]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PYRAMKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxamine 5'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=247.167}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite PYRIDOXAMINE-5P
- common-name:
- pyridoxamine 5'-phosphate
- smiles:
- cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
- inchi-key:
- zmjgsosnspkhnh-uhfffaoysa-m
- molecular-weight:
- 247.167
