Difference between revisions of "SJ09376"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntB Holo-EntB] == * common-name: ** a holo-[entb isochorismatase/aryl-carrier protein] ==...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntB Holo-EntB] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
 
* common-name:
 
* common-name:
** a holo-[entb isochorismatase/aryl-carrier protein]
+
** linoleoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** yecllimzhnyfck-rrnjgntnsa-j
 +
* molecular-weight:
 +
** 1025.937
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.14.19.3-RXN]]
 +
* [[FACOAE182]]
 +
* [[LINOLEOYL-RXN]]
 +
* [[RXN-16094]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ENTDB-RXN]]
+
* [[LNLCCOAL]]
 +
* [[RXN-16045]]
 +
* [[RXN-9601]]
 +
* [[RXN-9673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[entb isochorismatase/aryl-carrier protein]}}
+
{{#set: common-name=linoleoyl-coa}}
 +
{{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}}
 +
{{#set: molecular-weight=1025.937}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-18

  • common-name:
    • linoleoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yecllimzhnyfck-rrnjgntnsa-j
  • molecular-weight:
    • 1025.937

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality