Difference between revisions of "SJ09366"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Stearoyl-L-Phosphatidate 1-Stearoyl-L-Phosphatidate] == * common-name: ** a 1-stearoyl 2-acyl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * common-name: ** n-acetyl-α-d-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-α-d-glucosamine 1-phosphate |
| + | * smiles: | ||
| + | ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1) | ||
| + | * inchi-key: | ||
| + | ** fzljpepaypummr-fmdgeedcsa-l | ||
| + | * molecular-weight: | ||
| + | ** 299.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[NAG1P-URIDYLTRANS-RXN]] | ||
| + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.3.1.157-RXN]] |
| + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
| + | * [[RXN-16426]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}} | ||
| + | {{#set: molecular-weight=299.174}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- common-name:
- n-acetyl-α-d-glucosamine 1-phosphate
- smiles:
- cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
- inchi-key:
- fzljpepaypummr-fmdgeedcsa-l
- molecular-weight:
- 299.174
