Difference between revisions of "SJ09652"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCERATE GLYCERATE] == * common-name: ** d-glycerate * smiles: ** c(=o)([o-])c(o)co * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** cytidine |
* smiles: | * smiles: | ||
| − | ** c(=o) | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uhdgcwiwmrvcdj-xvfcmesisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 243.219 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ATCY]] |
| − | * [[ | + | * [[ATDTD]] |
| − | * [[ | + | * [[ATDTDm]] |
| − | * [[RXN0- | + | * [[CYTIDEAM2-RXN]] |
| − | * [[ | + | * [[DATCY]] |
| + | * [[DCTCP]] | ||
| + | * [[DGTCY]] | ||
| + | * [[DTTGY]] | ||
| + | * [[DTTPtm]] | ||
| + | * [[DUTCP]] | ||
| + | * [[GTCY]] | ||
| + | * [[ITCY]] | ||
| + | * [[RXN0-361]] | ||
| + | * [[UTCY]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ATDTM]] |
| − | * [[ | + | * [[DTTGY]] |
| − | * [[ | + | * [[DTTPtm]] |
| − | * [[ | + | * [[DTTUP]] |
| + | * [[RXN-14026]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cytidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=243.219}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CYTIDINE
- common-name:
- cytidine
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
- inchi-key:
- uhdgcwiwmrvcdj-xvfcmesisa-n
- molecular-weight:
- 243.219
