Difference between revisions of "SJ08104"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENZYME-S-SULFANYLCYSTEINE ENZYME-S-SULFANYLCYSTEINE] == * common-name: ** a [protein]-s-sulfany...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENZYME-S-SULFANYLCYSTEINE ENZYME-S-SULFANYLCYSTEINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] ==
 
* common-name:
 
* common-name:
** a [protein]-s-sulfanyl-l-cysteine
+
** (r)-mevalonate 5-phosphate
 +
* smiles:
 +
** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
 +
* inchi-key:
 +
** okzycxhttzzysk-zcfiwibfsa-k
 +
* molecular-weight:
 +
** 225.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16820]]
+
* [[MEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-s-sulfanyl-l-cysteine}}
+
{{#set: common-name=(r)-mevalonate 5-phosphate}}
 +
{{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}}
 +
{{#set: molecular-weight=225.115}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-499

  • common-name:
    • (r)-mevalonate 5-phosphate
  • smiles:
    • cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
  • inchi-key:
    • okzycxhttzzysk-zcfiwibfsa-k
  • molecular-weight:
    • 225.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality