Difference between revisions of "SJ19115"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] ==
 
* common-name:
 
* common-name:
** scopoletin
+
** 1-18:2-2-18:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
* inchi-key:
** rodxrvnmmdrfik-uhfffaoysa-n
+
** broompuvdptgeg-rhnbirjrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 192.171
+
** 779.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8366]]
 +
* [[RXN-8367]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14179]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=scopoletin}}
+
{{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=rodxrvnmmdrfik-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}}
{{#set: molecular-weight=192.171}}
+
{{#set: molecular-weight=779.105}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-8165

  • common-name:
    • 1-18:2-2-18:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
  • inchi-key:
    • broompuvdptgeg-rhnbirjrsa-n
  • molecular-weight:
    • 779.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality