Difference between revisions of "SJ22263"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * common-name: ** s-prenyl-l-cysteine * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * common-name: ** s-ribosyl-l-homocysteine * smiles: ** c(cc([n+])c(=o)[o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == |
* common-name: | * common-name: | ||
| − | ** s- | + | ** s-ribosyl-l-homocysteine |
* smiles: | * smiles: | ||
| − | ** cc | + | ** c(cc([n+])c(=o)[o-])scc1(oc(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iqfwynfdwrysra-oeqwsmlssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 267.296 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=s- | + | {{#set: common-name=s-ribosyl-l-homocysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iqfwynfdwrysra-oeqwsmlssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=267.296}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-564
- common-name:
- s-ribosyl-l-homocysteine
- smiles:
- c(cc([n+])c(=o)[o-])scc1(oc(o)c(o)c(o)1)
- inchi-key:
- iqfwynfdwrysra-oeqwsmlssa-n
- molecular-weight:
- 267.296
