Difference between revisions of "SJ14862"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * common-name: ** ferroheme b * smiles: ** c=cc1(c(c)=c7(c=c8(c(c)=c(cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-7-DIMETHYLXANTHINE 1-7-DIMETHYLXANTHINE] == * common-name: ** paraxanthine * smiles: ** cn2(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-7-DIMETHYLXANTHINE 1-7-DIMETHYLXANTHINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** paraxanthine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qunwudvfrngtco-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.166 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11520]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=paraxanthine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.166}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite 1-7-DIMETHYLXANTHINE
- common-name:
- paraxanthine
- smiles:
- cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
- inchi-key:
- qunwudvfrngtco-uhfffaoysa-n
- molecular-weight:
- 180.166
