Difference between revisions of "SJ06382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP] == * common-na...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP] ==
 
* common-name:
 
* common-name:
** 2'-hydroxynicotine
+
** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
 
* smiles:
 
* smiles:
** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2))
+
** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
 
* inchi-key:
 
* inchi-key:
** boqrppfuushfgw-snvbaglbsa-o
+
** agqjqcfepuvxnk-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 179.241
+
** 296.093
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12610]]
 +
* [[RXN-12611]]
 +
* [[THI-P-SYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-146]]
+
* [[PYRIMSYN3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-hydroxynicotine}}
+
{{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}}
{{#set: inchi-key=inchikey=boqrppfuushfgw-snvbaglbsa-o}}
+
{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}
{{#set: molecular-weight=179.241}}
+
{{#set: molecular-weight=296.093}}

Revision as of 09:23, 27 August 2019

Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP

  • common-name:
    • 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
  • smiles:
    • cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
  • inchi-key:
    • agqjqcfepuvxnk-uhfffaoysa-k
  • molecular-weight:
    • 296.093

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality