Difference between revisions of "SJ12469"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-EPINEPHRINE L-EPINEPHRINE] == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8086 CPD-8086] == * common-name: ** 1-linoleoyl-2-palmitoyl-phosphatidylglycerol * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-EPINEPHRINE L-EPINEPHRINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8086 CPD-8086] ==
 
* common-name:
 
* common-name:
** (r)-adrenaline
+
** 1-linoleoyl-2-palmitoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** c[n+]cc(o)c1(c=cc(=c(c=1)o)o)
+
** cccccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** uctwmzqnuqwslp-vifpvbqesa-o
+
** iykxcqwbmrybpi-wlgrlvtesa-m
 
* molecular-weight:
 
* molecular-weight:
** 184.214
+
** 745.992
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10908]]
+
* [[RXN-8317]]
 +
* [[RXN-8318]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-adrenaline}}
+
{{#set: common-name=1-linoleoyl-2-palmitoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=uctwmzqnuqwslp-vifpvbqesa-o}}
+
{{#set: inchi-key=inchikey=iykxcqwbmrybpi-wlgrlvtesa-m}}
{{#set: molecular-weight=184.214}}
+
{{#set: molecular-weight=745.992}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-8086

  • common-name:
    • 1-linoleoyl-2-palmitoyl-phosphatidylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • iykxcqwbmrybpi-wlgrlvtesa-m
  • molecular-weight:
    • 745.992

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality