Difference between revisions of "SJ19549"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETAMIDE ACETAMIDE] == * common-name: ** acetamide * smiles: ** cc(=o)n * inchi-key: ** dlfvbj...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12777 CPD-12777] == * common-name: ** (3r)-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(scc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETAMIDE ACETAMIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12777 CPD-12777] ==
 
* common-name:
 
* common-name:
** acetamide
+
** (3r)-hydroxydecanoyl-coa
 
* smiles:
 
* smiles:
** cc(=o)n
+
** cccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** dlfvbjfmpxgrib-uhfffaoysa-n
+
** hivsmyzamunfkz-dulmrfqqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 59.068
+
** 933.753
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14728]]
+
* [[RXN-14805]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11797]]
 +
* [[RXN-14805]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetamide}}
+
{{#set: common-name=(3r)-hydroxydecanoyl-coa}}
{{#set: inchi-key=inchikey=dlfvbjfmpxgrib-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=hivsmyzamunfkz-dulmrfqqsa-j}}
{{#set: molecular-weight=59.068}}
+
{{#set: molecular-weight=933.753}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-12777

  • common-name:
    • (3r)-hydroxydecanoyl-coa
  • smiles:
    • cccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • hivsmyzamunfkz-dulmrfqqsa-j
  • molecular-weight:
    • 933.753

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality