Difference between revisions of "SJ01938"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7206 CPD-7206] == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Aminoacyl-tRNA N-Substituted-Aminoacyl-tRNA] == * common-name: ** an n-modified a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7206 CPD-7206] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Aminoacyl-tRNA N-Substituted-Aminoacyl-tRNA] ==
 
* common-name:
 
* common-name:
** 8'-apo-β-carotenal
+
** an n-modified aminoacyl-[trna]
* smiles:
 
** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c
 
* inchi-key:
 
** dfmmvlfmmaqxhz-dokbywhisa-n
 
* molecular-weight:
 
** 416.645
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11783]]
+
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8'-apo-β-carotenal}}
+
{{#set: common-name=an n-modified aminoacyl-[trna]}}
{{#set: inchi-key=inchikey=dfmmvlfmmaqxhz-dokbywhisa-n}}
 
{{#set: molecular-weight=416.645}}
 

Revision as of 09:24, 27 August 2019

Metabolite N-Substituted-Aminoacyl-tRNA

  • common-name:
    • an n-modified aminoacyl-[trna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-modified aminoacyl-[trna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.