Difference between revisions of "SJ03386"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-71 CPD-71] == * common-name: ** (25r)-3α,7α,12α-trihydroxy-5β-choles...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hzsajdvwzrbgif-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 343.317 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-3542]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12610]] |
| + | * [[RXN-12611]] | ||
| + | * [[RXN0-3542]] | ||
| + | * [[THI-P-SYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=343.317}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite THIAMINE-P
- common-name:
- thiamine phosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- hzsajdvwzrbgif-uhfffaoysa-m
- molecular-weight:
- 343.317
