Difference between revisions of "SJ21744"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPHENOXAZINE ISOPHENOXAZINE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OXOBUTANOATE 2-OXOBUTANOATE] ==
 * common-name:
-** isophenoxazine
+** 2-oxobutanoate
 * smiles:
-** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
+** ccc(=o)c(=o)[o-]
 * inchi-key:
-** rdjxpxhqenrcng-uhfffaoysa-n
+** tyeybosbbbhjiv-uhfffaoysa-m
 * molecular-weight:
-** 212.207
+** 101.082
 == Reaction(s) known to consume the compound ==
+* [[RXN-13719]]
+* [[RXN-7790]]
 == Reaction(s) known to produce the compound ==
-* [[O-AMINOPHENOL-OXIDASE-RXN]]
+* [[4.1.99.4-RXN]]
+* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
+* [[HOMOSERDEAM-RXN]]
+* [[METBALT-RXN]]
+* [[RXN-13719]]
+* [[RXN-15130]]
+* [[RXN-7745]]
+* [[THREDEHYD-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=isophenoxazine}}
+{{#set: common-name=2-oxobutanoate}}
-{{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=tyeybosbbbhjiv-uhfffaoysa-m}}
-{{#set: molecular-weight=212.207}}
+{{#set: molecular-weight=101.082}}