Difference between revisions of "SJ08829"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tau-proteins Tau-proteins] == * common-name: ** a tau protein == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxytryptophol |
| + | * smiles: | ||
| + | ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) | ||
| + | * inchi-key: | ||
| + | ** kqrohcsyogbqgj-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 177.202 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10782]] |
| + | * [[RXN-10784]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10781]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxytryptophol}} |
| + | {{#set: inchi-key=inchikey=kqrohcsyogbqgj-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=177.202}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-11671
- common-name:
- 5-hydroxytryptophol
- smiles:
- c(o)cc1(=cnc2(=c1c=c(o)c=c2))
- inchi-key:
- kqrohcsyogbqgj-uhfffaoysa-n
- molecular-weight:
- 177.202
