Difference between revisions of "SJ13227"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-BISPHOSPHATE INOSITOL-1-4-BISPHOSPHATE] == * common-name: ** d-myo-inositol (1,4)-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-BISPHOSPHATE INOSITOL-1-4-BISPHOSPHATE] ==
 
* common-name:
 
* common-name:
** anthranilate
+
** d-myo-inositol (1,4)-bisphosphate
 
* smiles:
 
* smiles:
** c(c1(c(=cc=cc=1)n))(=o)[o-]
+
** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** rwzyaggxghygmb-uhfffaoysa-m
+
** pelzspzcxgtumr-rtphhqfdsa-j
 
* molecular-weight:
 
* molecular-weight:
** 136.13
+
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[3.1.3.57-RXN]]
* [[PRTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[3.1.3.56-RXN]]
* [[PRTRANS-RXN]]
+
* [[RXN-13334]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anthranilate}}
+
{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
{{#set: molecular-weight=136.13}}
+
{{#set: molecular-weight=336.085}}

Revision as of 09:24, 27 August 2019

Metabolite INOSITOL-1-4-BISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • pelzspzcxgtumr-rtphhqfdsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality