Difference between revisions of "SJ13227"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-BISPHOSPHATE INOSITOL-1-4-BISPHOSPHATE] == * common-name: ** d-myo-inositol (1,4)-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-BISPHOSPHATE INOSITOL-1-4-BISPHOSPHATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol (1,4)-bisphosphate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pelzspzcxgtumr-rtphhqfdsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.1.3.57-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.3.56-RXN]] |
− | * [[ | + | * [[RXN-13334]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (1,4)-bisphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite INOSITOL-1-4-BISPHOSPHATE
- common-name:
- d-myo-inositol (1,4)-bisphosphate
- smiles:
- c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
- inchi-key:
- pelzspzcxgtumr-rtphhqfdsa-j
- molecular-weight:
- 336.085