Difference between revisions of "SJ08954"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATIDYLCHOLINE PHOSPHATIDYLCHOLINE] ==
 * common-name:
-** triiodothyroacetate ether glucuronide
+** a phosphatidylcholine
-* smiles:
-** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
-* inchi-key:
-** vxvbzmwowmhxtq-kfyubchvsa-l
-* molecular-weight:
-** 796.046
 == Reaction(s) known to consume the compound ==
+* [[2.3.1.23-RXN]]
+* [[2.7.8.27-RXN]]
+* [[PHOSCHOL-RXN]]
+* [[PHOSPHOLIPASE-A1-RXN]]
+* [[PHOSPHOLIPASE-A2-RXN]]
+* [[PHOSPHOLIPASE-C-RXN]]
+* [[RXN-1501_METACYC18.5]]
+* [[RXN-15211]]
+* [[RXN-5781]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10619]]
+* [[2.3.1.23-RXN]]
+* [[2.7.8.27-RXN]]
+* [[RXN-5781]]
+* [[RXN4FS-2]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=triiodothyroacetate ether glucuronide}}
+{{#set: common-name=a phosphatidylcholine}}
-{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
-{{#set: molecular-weight=796.046}}