Difference between revisions of "SJ06413"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8462 CPD-8462] == * common-name: ** pentadecanoate * smiles: ** ccccccccccccccc([o-])=o * i...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * common-name: ** 2-(α-hydroxyeth...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8462 CPD-8462] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
 
* common-name:
 
* common-name:
** pentadecanoate
+
** 2-(α-hydroxyethyl)thiamine diphosphate
 
* smiles:
 
* smiles:
** ccccccccccccccc([o-])=o
+
** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
 
* inchi-key:
 
* inchi-key:
** wqepluugtldzjy-uhfffaoysa-m
+
** rruvjgasjonmdy-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 241.393
+
** 466.341
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PDHam2hi]]
 +
* [[PDHam2mi]]
 +
* [[RXN-12508]]
 +
* [[RXN-14037]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]]
+
* [[RXN-12583]]
 +
* [[RXN-14037]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pentadecanoate}}
+
{{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}}
{{#set: inchi-key=inchikey=wqepluugtldzjy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}}
{{#set: molecular-weight=241.393}}
+
{{#set: molecular-weight=466.341}}

Revision as of 09:24, 27 August 2019

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • common-name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • smiles:
    • cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
  • inchi-key:
    • rruvjgasjonmdy-uhfffaoysa-l
  • molecular-weight:
    • 466.341

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality