Difference between revisions of "SJ09655"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil47-in-tRNAs Uracil47-in-tRNAs] == * common-name: ** a uracil47 in trna == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil47-in-tRNAs Uracil47-in-tRNAs] ==
 
* common-name:
 
* common-name:
** 11-oxo-β-amyrin
+
** a uracil47 in trna
* smiles:
 
** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
 
* inchi-key:
 
** ukaiybgrlwqhdq-vcuiepqisa-n
 
* molecular-weight:
 
** 440.708
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13492]]
+
* [[RXN-12457]]
* [[RXN-13506]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=11-oxo-β-amyrin}}
+
{{#set: common-name=a uracil47 in trna}}
{{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}}
 
{{#set: molecular-weight=440.708}}
 

Revision as of 09:24, 27 August 2019

Metabolite Uracil47-in-tRNAs

  • common-name:
    • a uracil47 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality