Difference between revisions of "SJ01270"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methoxy-6-(all-trans-nonaprenyl)phenol |
* smiles: | * smiles: | ||
| − | ** cc(c)(c | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xryxraoxvpwhhk-ssrazkmssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 737.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9240]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=737.203}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-9866
- common-name:
- 2-methoxy-6-(all-trans-nonaprenyl)phenol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
- inchi-key:
- xryxraoxvpwhhk-ssrazkmssa-n
- molecular-weight:
- 737.203
