Difference between revisions of "SJ21226"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8050 CPD-8050] == * common-name: ** scyllo-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8050 CPD-8050] ==
 
* common-name:
 
* common-name:
** d-glucono-1,5-lactone
+
** scyllo-inositol
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(c(c1o)o)o)=o)
+
** c1(c(c(c(c(c1o)o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** phoqvhqstubqqk-sqougzdysa-n
+
** cdaismweouebre-cdrysyessa-n
 
* molecular-weight:
 
* molecular-weight:
** 178.141
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOLACT-RXN]]
+
* [[RXN-13779]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13779]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucono-1,5-lactone}}
+
{{#set: common-name=scyllo-inositol}}
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
+
{{#set: inchi-key=inchikey=cdaismweouebre-cdrysyessa-n}}
{{#set: molecular-weight=178.141}}
+
{{#set: molecular-weight=180.157}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-8050

  • common-name:
    • scyllo-inositol
  • smiles:
    • c1(c(c(c(c(c1o)o)o)o)o)o
  • inchi-key:
    • cdaismweouebre-cdrysyessa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality