Difference between revisions of "SJ11151"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] == * common-name: ** α-l-fucopyranose * smiles: ** cc1(oc(c(c(c1o)o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
 
* common-name:
 
* common-name:
** α-l-fucopyranose
+
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
 
* smiles:
 
* smiles:
** cc1(oc(c(c(c1o)o)o)o)
+
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
 
* inchi-key:
 
* inchi-key:
** shzgcjcmobcmkk-sxuwkvjysa-n
+
** oplvztyvquwkhb-sdbhatresa-k
 
* molecular-weight:
 
* molecular-weight:
** 164.158
+
** 572.278
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5298]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5298]]
+
* [[RXN-4303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-l-fucopyranose}}
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
{{#set: inchi-key=inchikey=shzgcjcmobcmkk-sxuwkvjysa-n}}
+
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
{{#set: molecular-weight=164.158}}
+
{{#set: molecular-weight=572.278}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-4201

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • oplvztyvquwkhb-sdbhatresa-k
  • molecular-weight:
    • 572.278

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality