Difference between revisions of "SJ13753"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15658 CPD-15658] == * common-name: ** (3r)-hydroxy-nonanoyl-coa * smiles: ** ccccccc(o)cc(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * common-name: ** apo-4'-lycopenal * smiles: ** cc(c)=cccc(c)=cc=cc(c)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == |
* common-name: | * common-name: | ||
| − | ** | + | ** apo-4'-lycopenal |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qpkntqummsiklq-ymwarttesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 482.748 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11999]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=apo-4'-lycopenal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qpkntqummsiklq-ymwarttesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=482.748}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-12936
- common-name:
- apo-4'-lycopenal
- smiles:
- cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o
- inchi-key:
- qpkntqummsiklq-ymwarttesa-n
- molecular-weight:
- 482.748
