Difference between revisions of "SJ14441"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2186 CPD-2186] == * common-name: ** 1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylgl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2186 CPD-2186] ==
 
* common-name:
 
* common-name:
** phytyl monophosphate
+
** 1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
+
** ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** yrxrhzokdfcxib-pyddkjgssa-l
+
** dsofjfhiqqefsk-xvncuxiasa-m
 
* molecular-weight:
 
* molecular-weight:
** 374.499
+
** 741.961
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7683]]
+
* [[RXN-1727]]
 +
* [[RXN-8319]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytyl monophosphate}}
+
{{#set: common-name=1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
+
{{#set: inchi-key=inchikey=dsofjfhiqqefsk-xvncuxiasa-m}}
{{#set: molecular-weight=374.499}}
+
{{#set: molecular-weight=741.961}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-2186

  • common-name:
    • 1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • dsofjfhiqqefsk-xvncuxiasa-m
  • molecular-weight:
    • 741.961

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality