Difference between revisions of "SJ03217"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
 
* common-name:
 
* common-name:
** queuine
+
** 2-hydroxy-datp
 
* smiles:
 
* smiles:
** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
+
** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** wyrolenthwjflr-acldmzeesa-o
+
** uoacbprdwrdehj-kvqbguixsa-j
 
* molecular-weight:
 
* molecular-weight:
** 278.29
+
** 503.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
* [[RXN0-6957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=queuine}}
+
{{#set: common-name=2-hydroxy-datp}}
{{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}}
+
{{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}}
{{#set: molecular-weight=278.29}}
+
{{#set: molecular-weight=503.152}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13851

  • common-name:
    • 2-hydroxy-datp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
  • inchi-key:
    • uoacbprdwrdehj-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality