Difference between revisions of "SJ05289"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-130 CPD1F-130] == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == |
* common-name: | * common-name: | ||
| − | ** | + | ** phenylacetylglycine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** utyvdvlmyqplqb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 192.194 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10821]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phenylacetylglycine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=utyvdvlmyqplqb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=192.194}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-11715
- common-name:
- phenylacetylglycine
- smiles:
- c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1)
- inchi-key:
- utyvdvlmyqplqb-uhfffaoysa-m
- molecular-weight:
- 192.194
