Difference between revisions of "SJ22164"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-GLYCEROL L-1-PHOSPHATIDYL-GLYCEROL] == * common-name: ** an l-1-phosphatidyl-s...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** chorismate |
| + | * smiles: | ||
| + | ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) | ||
| + | * inchi-key: | ||
| + | ** wtfxtqvdakgdey-htqzyqbosa-l | ||
| + | * molecular-weight: | ||
| + | ** 224.17 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ANTHRANSYN-RXN]] |
| − | * [[RXN- | + | * [[CHORISMATEMUT-RXN]] |
| + | * [[ISOCHORSYN-RXN]] | ||
| + | * [[PABASYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ANTHRANSYN-RXN]] |
| + | * [[CHORISMATE-SYNTHASE-RXN]] | ||
| + | * [[CHORISMATEMUT-RXN]] | ||
| + | * [[ISOCHORSYN-RXN]] | ||
| + | * [[PABASYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=chorismate}} |
| + | {{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}} | ||
| + | {{#set: molecular-weight=224.17}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CHORISMATE
- common-name:
- chorismate
- smiles:
- c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
- inchi-key:
- wtfxtqvdakgdey-htqzyqbosa-l
- molecular-weight:
- 224.17
