Difference between revisions of "SJ02299"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE] == * common-name:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] ==
 
* common-name:
 
* common-name:
** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
+
** n7-methylguanosine 5'-diphosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
+
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
 
* inchi-key:
 
* inchi-key:
** bjlpwucpfajinb-uaqstnrtsa-l
+
** sbasprrecyvbrf-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 442.531
+
** 455.214
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.42-RXN]]
+
* [[RXN-12817]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.41-RXN]]
+
* [[RXN-12817]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
+
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
{{#set: molecular-weight=442.531}}
+
{{#set: molecular-weight=455.214}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13855

  • common-name:
    • n7-methylguanosine 5'-diphosphate
  • smiles:
    • c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
  • inchi-key:
    • sbasprrecyvbrf-kqynxxcusa-l
  • molecular-weight:
    • 455.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality