Difference between revisions of "SJ22323"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-611 CPD-611] == * common-name: ** thiamine triphosphate * smiles: ** cc1([n+](=csc(ccop([o-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * common-name: ** bupropion * smiles: ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == |
* common-name: | * common-name: | ||
| − | ** | + | ** bupropion |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** snppwiuozrmyny-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 240.752 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-181]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=bupropion}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=snppwiuozrmyny-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=240.752}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-3481
- common-name:
- bupropion
- smiles:
- cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1)
- inchi-key:
- snppwiuozrmyny-uhfffaoysa-o
- molecular-weight:
- 240.752
