Difference between revisions of "SJ14827"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-holder Peptides-holder] == * common-name: ** a peptide == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE] == * common-name:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o | ||
+ | * inchi-key: | ||
+ | ** bjlpwucpfajinb-uaqstnrtsa-l | ||
+ | * molecular-weight: | ||
+ | ** 442.531 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.5.1.42-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[2.5.1.41-RXN]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}} |
+ | {{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}} | ||
+ | {{#set: molecular-weight=442.531}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE
- common-name:
- 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
- inchi-key:
- bjlpwucpfajinb-uaqstnrtsa-l
- molecular-weight:
- 442.531