Difference between revisions of "SJ01770"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] == * common-name: ** (s)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13852 CPD-13852] == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13852 CPD-13852] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-hydroxy-damp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** geqdrkvfkbspsw-kvqbguixsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 345.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-6957]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-damp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=geqdrkvfkbspsw-kvqbguixsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=345.208}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-13852
- common-name:
- 2-hydroxy-damp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o
- inchi-key:
- geqdrkvfkbspsw-kvqbguixsa-l
- molecular-weight:
- 345.208
