Difference between revisions of "SJ07759"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] ==
 * common-name:
-** a [protein] c-terminal s-farnesyl-l-cysteine methyl ester
+** l-tyrosine
+* smiles:
+** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-]
+* inchi-key:
+** ouycccasqsfeme-qmmmgpobsa-n
+* molecular-weight:
+** 181.191
 == Reaction(s) known to consume the compound ==
-* [[RXN-8409]]
+* [[6.3.2.25-RXN]]
+* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+* [[RXN-11319]]
+* [[RXN-5861]]
+* [[TYROSINE--TRNA-LIGASE-RXN]]
+* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+* [[TYROSINE-DECARBOXYLASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[2.1.1.100-RXN]]
+* [[RXN-5682]]
+* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine methyl ester}}
+{{#set: common-name=l-tyrosine}}
+{{#set: inchi-key=inchikey=ouycccasqsfeme-qmmmgpobsa-n}}
+{{#set: molecular-weight=181.191}}