Difference between revisions of "SJ04607"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=12-EPOXYPROPANE 12-EPOXYPROPANE] ==
 * common-name:
-** phytyl diphosphate
+** 1,2-epoxypropane
-* smiles:
-** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
-* inchi-key:
-** itplbnccpzsweu-pyddkjgssa-k
-* molecular-weight:
-** 453.471
 == Reaction(s) known to consume the compound ==
-* [[RXN-2541]]
+* [[RXN-17617]]
-* [[RXN-7660]]
+* [[RXN-17622]]
-* [[RXN-7674]]
-* [[RXN1F-66]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10625]]
+* [[RXN-17622]]
-* [[RXN-7660]]
-* [[RXN1F-66]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=phytyl diphosphate}}
+{{#set: common-name=1,2-epoxypropane}}
-{{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}}
-{{#set: molecular-weight=453.471}}