Difference between revisions of "SJ09107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-] == * common-name...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15189 CPD-15189] == * common-name: ** chenodeoxycholate * smiles: ** cc(ccc(=o)[o-])[ch]2(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15189 CPD-15189] ==
 
* common-name:
 
* common-name:
** udp-β-l-threo-pentapyranos-4-ulose
+
** chenodeoxycholate
 
* smiles:
 
* smiles:
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
+
** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](ccc(c)23)4))))
 
* inchi-key:
 
* inchi-key:
** urjziqltpcjvmw-qnsckltrsa-l
+
** rudatbohqwojdd-bswaidmhsa-m
 
* molecular-weight:
 
* molecular-weight:
** 532.247
+
** 391.57
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1863]]
+
* [[RXN-16033]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1863]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-β-l-threo-pentapyranos-4-ulose}}
+
{{#set: common-name=chenodeoxycholate}}
{{#set: inchi-key=inchikey=urjziqltpcjvmw-qnsckltrsa-l}}
+
{{#set: inchi-key=inchikey=rudatbohqwojdd-bswaidmhsa-m}}
{{#set: molecular-weight=532.247}}
+
{{#set: molecular-weight=391.57}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-15189

  • common-name:
    • chenodeoxycholate
  • smiles:
    • cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](ccc(c)23)4))))
  • inchi-key:
    • rudatbohqwojdd-bswaidmhsa-m
  • molecular-weight:
    • 391.57

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality