Difference between revisions of "SJ18299"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * common-name: ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa * smile...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] ==
 
* common-name:
 
* common-name:
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
+
** 4-methylumbelliferone
 
* smiles:
 
* smiles:
** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
 
* inchi-key:
 
* inchi-key:
** xpvhxtguzgacru-mcfmhthasa-j
+
** hshnitrmyyllcv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 967.814
+
** 176.171
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14797]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14796]]
+
* [[3.1.1.56-RXN]]
 +
* [[RXN-10769]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa}}
+
{{#set: common-name=4-methylumbelliferone}}
{{#set: inchi-key=inchikey=xpvhxtguzgacru-mcfmhthasa-j}}
+
{{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}}
{{#set: molecular-weight=967.814}}
+
{{#set: molecular-weight=176.171}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-182

  • common-name:
    • 4-methylumbelliferone
  • smiles:
    • cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
  • inchi-key:
    • hshnitrmyyllcv-uhfffaoysa-n
  • molecular-weight:
    • 176.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality