Difference between revisions of "SJ01933"

Revision as of 09:25, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-with-Integrated-Transposon IS30-with-Integrated-Transposon] ==
 * common-name:
-** 5',5'''-diadenosine tetraphosphate
+** an insertion sequence is30 with integrated transposon
-* smiles:
-** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
-* inchi-key:
-** yoahknvsncmzgq-xpwfqurosa-j
-* molecular-weight:
-** 832.36
 == Reaction(s) known to consume the compound ==
-* [[3.6.1.41-RXN]]
+* [[RXN0-5131]]
-* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+* [[RXN0-5131]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
+{{#set: common-name=an insertion sequence is30 with integrated transposon}}
-{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
-{{#set: molecular-weight=832.36}}