Difference between revisions of "SJ21660"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common-name: ** 2,3-diphospho-d-glycerate * s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 2,3-diphospho-d-glycerate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xohueycvluuejj-uwtatzphsa-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 260.998 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15509]] |
− | * [[ | + | * [[RXN-15510]] |
− | * [[ | + | * [[RXN-15511]] |
− | * [[ | + | * [[RXN-15512]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] |
− | * [[ | + | * [[RXN-15509]] |
− | * [[ | + | * [[RXN-15510]] |
− | * [[ | + | * [[RXN-15511]] |
− | * [[ | + | * [[RXN-15512]] |
− | * [[ | + | * [[RXN-17276]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2,3-diphospho-d-glycerate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=260.998}} |
Revision as of 09:25, 27 August 2019
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common-name:
- 2,3-diphospho-d-glycerate
- smiles:
- c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
- inchi-key:
- xohueycvluuejj-uwtatzphsa-i
- molecular-weight:
- 260.998