Difference between revisions of "SJ19163"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-MET-tRNAs Charged-MET-tRNAs] == * common-name: ** an l-methionyl-[elongator trnamet] ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-MET-tRNAs Charged-MET-tRNAs] ==
 
* common-name:
 
* common-name:
** hypoglycin b
+
** an l-methionyl-[elongator trnamet]
* smiles:
 
** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
 
* inchi-key:
 
** uydzycpiqsrxku-nppuscpjsa-m
 
* molecular-weight:
 
** 269.277
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9157]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hypoglycin b}}
+
{{#set: common-name=an l-methionyl-[elongator trnamet]}}
{{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}}
 
{{#set: molecular-weight=269.277}}
 

Revision as of 09:25, 27 August 2019

Metabolite Charged-MET-tRNAs

  • common-name:
    • an l-methionyl-[elongator trnamet]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-methionyl-[elongator trnamet" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.