Difference between revisions of "SJ20174"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09945 == * transcription-direction: ** positive * right-end-position: ** 244797 * left-end-position: ** 217669 * centisome-position: ** 54.161472...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == |
− | + | * common-name: | |
− | + | ** 3-[(7'-methylthio)heptyl]malate | |
− | + | * smiles: | |
− | + | ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] | |
− | + | * inchi-key: | |
− | + | ** sxljfgxgvbwoob-uhfffaoysa-l | |
− | + | * molecular-weight: | |
− | + | ** 276.347 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-18200]] | |
− | + | * [[RXNQT-4178]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-18200]] |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=3-[(7'-methylthio)heptyl]malate}} |
− | + | {{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}} | |
− | * | + | {{#set: molecular-weight=276.347}} |
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | == | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPDQT-40
- common-name:
- 3-[(7'-methylthio)heptyl]malate
- smiles:
- cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- sxljfgxgvbwoob-uhfffaoysa-l
- molecular-weight:
- 276.347
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(7'-methylthio)heptyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.