Difference between revisions of "SJ05686"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02128 == * transcription-direction: ** negative * right-end-position: ** 56457 * left-end-position: ** 45594 * centisome-position: ** 32.26021...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11939 CPD-11939] == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetr...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02128 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11939 CPD-11939] ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
−
* right-end-position:
+
* smiles:
−
** 56457
+
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
−
* left-end-position:
+
* inchi-key:
−
** 45594
+
** hhqooerqsfjgep-zsiqdkgesa-a
−
* centisome-position:
+
* molecular-weight:
−
** 32.26021   
+
** 805.885
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10976]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-10973]]
−
* [[2.3.1.75-RXN]]
+
* [[RXN-10976]]
−
** Category: [[annotation]]
+
* [[RXN-10979]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=805.885}}
−
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12547]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12639]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-9356]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4193]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5885]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5884]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[TRIGLSYN-PWY]]
 
−
** '''5''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6873]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-282]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=56457}}
 
−
{{#set: left-end-position=45594}}
 
−
{{#set: centisome-position=32.26021    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 09:25, 27 August 2019

Metabolite CPD-11939

  • common-name:
    • 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
  • inchi-key:
    • hhqooerqsfjgep-zsiqdkgesa-a
  • molecular-weight:
    • 805.885

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05686&oldid=29315"