Difference between revisions of "PWY-7889"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3705 CPD-3705] == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c...")
(Created page with "Category:pathway == Pathway PWY-6964 == * taxonomic-range: ** tax-1117 ** tax-2836 ** tax-33090 * common-name: ** ammonia assimilation cycle ii == Reaction(s) found == * [...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3705 CPD-3705] ==
+
== Pathway PWY-6964 ==
 +
* taxonomic-range:
 +
** tax-1117
 +
** tax-2836
 +
** tax-33090
 
* common-name:
 
* common-name:
** adenosine 2'-monophosphate
+
** ammonia assimilation cycle ii
* smiles:
+
== Reaction(s) found ==
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
* inchi-key:
+
* [[GLUTAMINESYN-RXN]]
** qdfhpfsbqfllsw-kqynxxcusa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 345.208
+
{{#set: taxonomic-range=tax-33090|tax-2836|tax-1117}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=ammonia assimilation cycle ii}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN-12057]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=adenosine 2'-monophosphate}}
 
{{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}}
 
{{#set: molecular-weight=345.208}}
 

Revision as of 20:15, 18 December 2020

Pathway PWY-6964

  • taxonomic-range:
    • tax-1117
    • tax-2836
    • tax-33090
  • common-name:
    • ammonia assimilation cycle ii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present