Difference between revisions of "PWY-5344"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] ==
+== Pathway PWY1-3 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** ubiquinone-8
+** polyhydroxybutanoate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-* inchi-key:
+* [[RXN-5901]]
-** icfizjqgjajrsu-sghxuwjisa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN1-42 RXN1-42]
-** 727.121
+{{#set: taxonomic-range=tax-2|tax-2157}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=polyhydroxybutanoate biosynthesis}}
-* [[R00281]]
+{{#set: nb reaction found=2}}
-* [[SUCDH_LPAREN_q8_RPAREN_m]]
+{{#set: completion rate=0.67}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=3}}
-* [[R00281]]
-* [[SUCDH_LPAREN_q8_RPAREN_m]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=ubiquinone-8}}
-{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
-{{#set: molecular-weight=727.121}}