Difference between revisions of "PWY-5130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * common-name: ** (s)-5-hydroxyisourate * smiles: ** c2...")
(Created page with "Category:pathway == Pathway PWY-5130 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** 2-oxobutanoate degradation i == Reaction(s) found == * RXN-7790 == Re...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] ==
+
== Pathway PWY-5130 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** (s)-5-hydroxyisourate
+
** 2-oxobutanoate degradation i
* smiles:
+
== Reaction(s) found ==
** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
+
* [[RXN-7790]]
* inchi-key:
+
== Reaction(s) not found ==
** ltqypavlayvktk-yfkpbyrvsa-n
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2|tax-2759}}
** 184.111
+
{{#set: common-name=2-oxobutanoate degradation i}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[3.5.2.17-RXN]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
* [[URATE-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(s)-5-hydroxyisourate}}
 
{{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}}
 
{{#set: molecular-weight=184.111}}
 

Revision as of 20:16, 18 December 2020

Pathway PWY-5130

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • 2-oxobutanoate degradation i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present