Difference between revisions of "PWY-5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(...")
(Created page with "Category:pathway == Pathway PWY66-391 == * taxonomic-range: ** tax-7742 * common-name: ** fatty acid β-oxidation vi (peroxisome) == Reaction(s) found == * ACYLCOASY...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] ==
+
== Pathway PWY66-391 ==
 +
* taxonomic-range:
 +
** tax-7742
 
* common-name:
 
* common-name:
** raffinose
+
** fatty acid β-oxidation vi (peroxisome)
* smiles:
+
== Reaction(s) found ==
** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
+
* [[ACYLCOASYN-RXN]]
* inchi-key:
+
* [[ENOYL-COA-HYDRAT-RXN]]
** mupfekgtmrgplj-zqskzdjdsa-n
+
* [[KETOACYLCOATHIOL-RXN]]
* molecular-weight:
+
* [[OHACYL-COA-DEHYDROG-RXN]]
** 504.441
+
* [[RXN-11026]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-7699]]
* [[2.4.1.67-RXN]]
+
== Reaction(s) not found ==
* [[RXN-11502]]
+
* [NoneRXN66-485 RXN66-485]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-7742}}
* [[2.4.1.67-RXN]]
+
{{#set: common-name=fatty acid β-oxidation vi (peroxisome)}}
* [[2.4.1.82-RXN]]
+
{{#set: nb reaction found=6}}
* [[RXN-11501]]
+
{{#set: completion rate=0.86}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=7}}
{{#set: common-name=raffinose}}
 
{{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}}
 
{{#set: molecular-weight=504.441}}
 

Revision as of 20:16, 18 December 2020

Pathway PWY66-391

  • taxonomic-range:
    • tax-7742
  • common-name:
    • fatty acid β-oxidation vi (peroxisome)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN66-485 RXN66-485]