Difference between revisions of "GLUDEG-I-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+== Pathway GLUDEG-I-PWY ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** 3-oxododecanoyl-coa
+** gaba shunt
-* smiles:
+== Reaction(s) found ==
-** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[GABATRANSAM-RXN]]
-* inchi-key:
+* [[GLUTDECARBOX-RXN]]
-** hqanbzhvwidnqz-gmhmeamdsa-j
+* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 959.791
+* [NoneGLUTAMATE-DEHYDROGENASE-NADP+-RXN GLUTAMATE-DEHYDROGENASE-NADP+-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-33208}}
-* [[HACD5]]
+{{#set: common-name=gaba shunt}}
-* [[HACD5h]]
+{{#set: nb reaction found=3}}
-* [[HACD5m]]
+{{#set: completion rate=0.75}}
-* [[RXN-14274]]
+{{#set: nb total reaction=4}}
-== Reaction(s) known to produce the compound ==
-* [[HACD5]]
-* [[HACD5h]]
-* [[HACD5m]]
-* [[RXN-14274]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxododecanoyl-coa}}
-{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
-{{#set: molecular-weight=959.791}}